CAS 57-83-0: Pregn-4-ene-3,20-dione

Description:Pregn-4-ene-3,20-dione, commonly known as progesterone, is a naturally occurring steroid hormone involved in the regulation of various physiological processes, particularly in the female reproductive system. It is characterized by its structure, which includes a steroid backbone with a double bond at the 4-position and keto groups at the 3 and 20 positions. This compound plays a crucial role in the menstrual cycle, pregnancy, and embryogenesis. Progesterone is lipophilic, allowing it to easily cross cell membranes and bind to specific nuclear receptors, influencing gene expression. It is synthesized in the ovaries, placenta, and adrenal glands. In addition to its reproductive functions, progesterone has implications in various therapeutic applications, including hormone replacement therapy and treatment of certain menstrual disorders. Its CAS number, 57-83-0, is a unique identifier that facilitates the identification and study of this compound in scientific literature and regulatory contexts. Overall, progesterone is essential for reproductive health and has significant biological and clinical relevance.

Formula:C₂₁H₃₀O₂

InChI:InChI=1S/C21H30O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12,16-19H,4-11H2,1-3H3/t16-,17+,18-,19-,20-,21+/m0/s1

InChI key:InChIKey=RJKFOVLPORLFTN-LEKSSAKUSA-N

SMILES:O=C1C=C2CCC3C(CCC4(C)C(C(=O)C)CCC34)C2(C)CC1