CAS 570-52-5
:17α-Hydroxypregnanolone
Description:
17α-Hydroxypregnanolone, with the CAS number 570-52-5, is a steroid hormone that belongs to the class of neurosteroids. It is derived from progesterone and is characterized by its hydroxyl group at the 17α position. This compound plays a significant role in the central nervous system, influencing neuroprotection, neurogenesis, and modulating synaptic transmission. It is known to interact with various neurotransmitter systems, particularly GABA receptors, enhancing inhibitory neurotransmission. 17α-Hydroxypregnanolone is also involved in the regulation of mood and stress responses, making it a subject of interest in studies related to anxiety and depression. In terms of physical properties, it is typically a white to off-white crystalline solid, soluble in organic solvents but less so in water. Its biological activities and potential therapeutic applications are being explored, particularly in the context of neuropsychiatric disorders and neurodegenerative diseases. Overall, 17α-Hydroxypregnanolone is a significant compound in both biochemistry and pharmacology, with implications for understanding brain function and developing new treatments.
Formula:C21H34O3
InChI:InChI=1S/C21H34O3/c1-13(22)21(24)11-8-18-16-5-4-14-12-15(23)6-9-19(14,2)17(16)7-10-20(18,21)3/h14-18,23-24H,4-12H2,1-3H3/t14-,15-,16-,17+,18+,19+,20+,21+/m1/s1
InChI key:InChIKey=LKQDFQLSEHWIRK-UKBVDAKRSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@]4(C)[C@](CC3)(C[C@H](O)CC4)[H])(CC1)[H])[H])(CC[C@@]2(C(C)=O)O)[H]
Synonyms:- 3α,17α-Dihydroxy-5β-pregnan-20-one
- Pregnan-20-one, 3,17-dihydroxy-, (3α,5β)-
- (3α,5β)-3,17-Dihydroxypregnan-20-one
- 5β-Pregnan-20-one, 3α,17-dihydroxy-
- 17α-Hydroxypregnanolone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
