CAS 570-54-7
:3β,17α-Dihydroxy-5α-pregnan-20-one
Description:
3β,17α-Dihydroxy-5α-pregnan-20-one, commonly known as allopregnanolone, is a neuroactive steroid that plays a significant role in the central nervous system. It is derived from progesterone and is known for its potent modulatory effects on the GABA-A receptor, contributing to its anxiolytic and sedative properties. This compound is characterized by its steroidal structure, featuring hydroxyl groups at the 3β and 17α positions, which are crucial for its biological activity. Allopregnanolone is involved in various physiological processes, including mood regulation, stress response, and neuroprotection. It is also studied for its potential therapeutic applications in conditions such as anxiety disorders, depression, and epilepsy. The substance is typically found in the human body, particularly during pregnancy, and its levels can fluctuate based on hormonal changes. Its CAS number, 570-54-7, is used for identification in chemical databases and regulatory contexts. Overall, allopregnanolone is a significant compound in both biochemistry and pharmacology, with ongoing research into its diverse effects on human health.
Formula:C21H34O3
InChI:InChI=1S/C21H34O3/c1-13(22)21(24)11-8-18-16-5-4-14-12-15(23)6-9-19(14,2)17(16)7-10-20(18,21)3/h14-18,23-24H,4-12H2,1-3H3/t14-,15-,16+,17-,18-,19-,20-,21-/m0/s1
InChI key:InChIKey=LKQDFQLSEHWIRK-FJCZRMHDSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@]4(C)[C@@](CC3)(C[C@@H](O)CC4)[H])(CC1)[H])[H])(CC[C@@]2(C(C)=O)O)[H]
Synonyms:- (3Beta,5Alpha)-3,17-Dihydroxypregnan-20-One
- (3β,5α)-3,17-Dihydroxypregnan-20-one
- 3β,17-Dihydroxy-5α-pregnan-20-one
- 3β,17α-Dihydroxy-5α-pregnan-20-one
- 5α-Pregnan-20-one, 3β,17-dihydroxy-
- 5α-Pregnane-3β,17α-diol-20-one
- Allopregnane-3beta,17alpha-diol-20-one
- Allopregnane-3β,17α-diol-20-one
- Pregnan-20-one, 3,17-dihydroxy-, (3β,5α)-
- Reichstein's substance L
- Wintersteiner's compound G
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5alpha-Pregnan-3beta,17alpha-diol-20-one
CAS:Applications 5alpha-Pregnan-3beta,17alpha-diol-20-one (cas# 570-54-7) is a useful research chemical.
Formula:C21H34O3Color and Shape:Off-WhiteMolecular weight:334.495alpha-Pregnan-3beta,17alpha-diol-20-one
CAS:Controlled Product5alpha-Pregnan-3beta,17alpha-diol-20-one is a versatile building block that can be used in the synthesis of a wide range of chemical compounds. It has CAS number 570-54-7 and is useful as a reagent in organic chemistry. This compound is also an intermediate for the synthesis of other chemicals, such as steroids and hormones. 5alpha-Pregnan-3beta,17alpha-diol-20-one can be used to produce high quality products with diverse biological activities and molecular structures. The compound is also useful in the production of pharmaceuticals, pesticides, and herbicides.Formula:C21H34O3Purity:Min. 95%Color and Shape:PowderMolecular weight:334.49 g/mol

