CAS 5700-56-1
:1-phenylethane-1,2-diamine
Description:
1-Phenylethane-1,2-diamine, also known as phenethylamine-1,2-diamine, is an organic compound characterized by the presence of an ethane backbone with two amino groups (-NH2) and a phenyl group attached to one of the carbon atoms. This compound is a diamine, which means it contains two amine functional groups, making it potentially reactive and capable of forming various derivatives. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of amino groups allows for hydrogen bonding, which can influence its solubility in water and organic solvents. 1-Phenylethane-1,2-diamine can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, making it useful in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, due to its amine functionality, it may exhibit biological activity, although specific applications and safety considerations should be evaluated based on its reactivity and potential toxicity.
Formula:C8H12N2
InChI:InChI=1/C8H12N2/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8H,6,9-10H2
Synonyms:- 1-Phenylethane-1,2-diamine
- 1,2-ethanediamine, 1-phenyl-
- 1-Phenyl-1,2-ethanediamine
- 1-Phenyl-1,2-ethandiamin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Phenylethane-1,2-diamine
CAS:1-Phenylethane-1,2-diamine (1PD) is a diamine tetraacetic acid salt that is a conformational analogue of the chemokine CXCL12. It has been shown to bind to its receptor and inhibit chemotaxis in vitro. 1PD has also been shown to be stereoselective in its binding to the receptor, with the sodium salt showing greater selectivity for CXCR4 than CXCR5. The solvation of 1PD has been studied by spectroscopic techniques and it is found that the solvation process is dominated by hydrogen bonding interactions with solvent molecules. This drug has not yet been analysed for human use or toxicity.Formula:C8H12N2Purity:Min. 95%Molecular weight:136.19 g/mol


