CAS 57001-16-8

3,4,5,6,7,8-Hexahydro-2H-cycloheptathiazol-2-one

Description:

3,4,5,6,7,8-Hexahydro-2H-cycloheptathiazol-2-one, with the CAS number 57001-16-8, is a heterocyclic compound characterized by its unique ring structure that incorporates both sulfur and nitrogen atoms. This compound features a saturated cycloheptane ring fused with a thiazole moiety, which contributes to its chemical reactivity and potential biological activity. The presence of the thiazole ring suggests that it may exhibit properties typical of sulfur-containing heterocycles, such as antimicrobial or antifungal activities. Its molecular structure allows for various functionalization possibilities, making it of interest in synthetic organic chemistry. The compound is typically studied for its potential applications in pharmaceuticals and agrochemicals. Additionally, its physical properties, such as solubility and stability, can vary based on the specific conditions and solvents used. As with many heterocycles, understanding its reactivity and interactions with other chemical species is crucial for exploring its practical applications.

Formula: C₈H₁₁NOS

InChI: InChI=1S/C8H11NOS/c10-8-9-6-4-2-1-3-5-7(6)11-8/h1-5H2,(H,9,10)

InChI key: InChIKey=VGXLWHYMJAQRHX-UHFFFAOYSA-N

SMILES: O=C1NC2=C(S1)CCCCC2

Synonyms:

• 3,4,5,6,7,8-Hexahydro-2H-cycloheptathiazol-2-one
• 2H,3H,4H,5H,6H,7H,8H-Cyclohepta[d][1,3]thiazol-2-one
• 2H-Cycloheptathiazol-2-one, 3,4,5,6,7,8-hexahydro-

2H,3H,4H,5H,6H,7H,8H-Cyclohepta[D][1,3]thiazol-2-one

CAS: 57001-16-8

2H,3H,4H,5H,6H,7H,8H-Cyclohepta[D][1,3]thiazol-2-one is a synthetic compound that has been modified to produce various derivatives. It is used in the synthesis of oligosaccharides and polysaccharides. This chemical also has potential applications in the treatment of cancer and diabetes.

Formula: C₈H₁₁NOS

Purity: Min. 95%

Molecular weight: 169.25 g/mol

Ref: 3D-HCA00116