CAS 57005-14-8

1-(2-chloro-4-methylphenyl)thiourea

Description:

1-(2-Chloro-4-methylphenyl)thiourea, with the CAS number 57005-14-8, is an organic compound characterized by the presence of a thiourea functional group attached to a substituted aromatic ring. This compound features a chloro group and a methyl group on the phenyl ring, which influence its chemical reactivity and physical properties. Typically, thioureas exhibit properties such as moderate solubility in polar solvents and potential for hydrogen bonding due to the presence of the thiourea moiety. The chlorine substituent can enhance the compound's reactivity, making it useful in various synthetic applications, including the preparation of other organic compounds. Additionally, the presence of the methyl group can affect the steric hindrance and electronic properties of the molecule. As with many thioureas, this compound may also exhibit biological activity, making it of interest in pharmaceutical research. Safety data should be consulted for handling and potential toxicity, as halogenated compounds can pose environmental and health risks.

Formula: C₈H₉ClN₂S

InChI: InChI=1/C8H9ClN2S/c1-5-2-3-7(6(9)4-5)11-8(10)12/h2-4H,1H3,(H3,10,11,12)

SMILES: Cc1ccc(c(c1)Cl)NC(=N)S

(2-chloro-4-methylphenyl)thiourea

CAS: 57005-14-8

Formula: C₈H₉ClN₂S

Molecular weight: 200.6885

Ref: IN-DA01C2MM

(2-Chloro-4-methylphenyl)thiourea

CAS: 57005-14-8

Versatile small molecule scaffold

Formula: C₈H₉ClN₂S

Purity: Min. 95%

Molecular weight: 200.69 g/mol

Ref: 3D-HCA00514