
CAS 57018-12-9
:2,6-Dibromo-4-ethylphenol
Description:
2,6-Dibromo-4-ethylphenol is an organic compound characterized by the presence of two bromine atoms and an ethyl group attached to a phenolic structure. Its molecular formula typically includes carbon, hydrogen, and bromine, reflecting its aromatic nature. The compound is known for its potential applications in various fields, including as a biocide and in the synthesis of other chemical products. It exhibits moderate solubility in organic solvents, while its solubility in water is limited due to the hydrophobic nature of the brominated phenolic structure. The presence of bromine atoms contributes to its reactivity, making it useful in substitution reactions. Additionally, 2,6-Dibromo-4-ethylphenol may exhibit antimicrobial properties, which can be advantageous in industrial applications. However, like many brominated compounds, it may raise environmental and health concerns, necessitating careful handling and assessment of its ecological impact. Overall, this compound serves as an interesting subject for further research in both synthetic and applied chemistry contexts.
Formula:C8H8Br2O
InChI:InChI=1S/C8H8Br2O/c1-2-5-3-6(9)8(11)7(10)4-5/h3-4,11H,2H2,1H3
InChI key:InChIKey=XSNHMPFGJLEOTP-UHFFFAOYSA-N
SMILES:C(C)C1=CC(Br)=C(O)C(Br)=C1
Synonyms:- 2,6-Dibromo-4-ethylphenol
- Phenol, 2,6-dibromo-4-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.