CAS 57022-38-5

Propanamide, 3-amino-N-[2-(1H-imidazol-5-yl)ethyl]-, hydrochloride (1:2)

Description:

Propanamide, 3-amino-N-[2-(1H-imidazol-5-yl)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its amide functional group and an imidazole moiety, which contributes to its biological activity. The presence of the amino group enhances its solubility in water and potential for interaction with biological systems. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for pharmaceutical applications. This compound may exhibit properties such as being a potential drug candidate, particularly in the context of targeting specific biological pathways or receptors due to the imidazole ring, which is known for its role in various biological processes. Its molecular structure suggests it could participate in hydrogen bonding, influencing its reactivity and interaction with other molecules. Additionally, the compound's characteristics, such as melting point, solubility, and stability, would be influenced by the presence of the hydrochloride group, which can affect its pharmacokinetics and pharmacodynamics in biological systems.

Formula: C₈H₁₄N₄O·2ClH

InChI: InChI=1S/C8H14N4O.2ClH/c9-3-1-8(13)11-4-2-7-5-10-6-12-7;;/h5-6H,1-4,9H2,(H,10,12)(H,11,13);2*1H

InChI key: InChIKey=ZQTUNIWBUQUKAM-UHFFFAOYSA-N

SMILES: C(CNC(CCN)=O)C1=CN=CN1.Cl

Synonyms:

• Propanamide, 3-amino-N-[2-(1H-imidazol-5-yl)ethyl]-, hydrochloride (1:2)
• Propanamide, 3-amino-N-[2-(1H-imidazol-4-yl)ethyl]-, dihydrochloride

Propanamide, 3-amino-N-2-(1H-imidazol-4-yl)ethyl-, dihydrochloride

CAS: 57022-38-5

Formula: C₈H₁₅ClN₄O

Purity: 95%

Color and Shape: Solid

Molecular weight: 218.6839

Ref: IN-DA00F0T6

N-(2-(1H-Imidazol-5-yl)ethyl)-3-aminopropanamide dihydrochloride

CAS: 57022-38-5

N-(2-(1H-Imidazol-5-yl)ethyl)-3-aminopropanamide dihydrochloride

Purity: 95%

Molecular weight: 255.15g/mol

Ref: 54-OR1071570

Carcinine DiHCl

CAS: 57022-38-5

Formula: C₈H₁₄N₄O·2HCl

Molecular weight: 182.23 2*36.46

Ref: 4Z-C-381001

Carcinine dihydrochloride

CAS: 57022-38-5

Carcinine dihydrochloride is a benzyl amine derivative that is produced by the reaction of malic acid with dehydroascorbic acid. It has been shown to have activity against radiation-induced oxidative stress and is also used as an antioxidant. Carcinine dihydrochloride has been shown to inhibit epidermal growth in rats and to reduce skin tumor incidence in mice. Carcinine dihydrochloride binds to fatty acids, which are involved in many cellular processes including cell growth and the immune response. This compound may also have anti-inflammatory properties due to its ability to inhibit the production of prostaglandins.

Formula: C₈H₁₄N₄O•(HCl)₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 255.14 g/mol

Ref: 3D-HCA02238