CymitQuimica logo

CAS 57025-76-0

:

methyl 2-chloro-5-[2-chloro-4-(trifluoromethyl)phenoxy]benzoate

Description:
Methyl 2-chloro-5-[2-chloro-4-(trifluoromethyl)phenoxy]benzoate, with the CAS number 57025-76-0, is an organic compound characterized by its complex structure, which includes a benzoate moiety and multiple halogen substituents. This compound features a methyl ester functional group, contributing to its solubility in organic solvents. The presence of chlorine and trifluoromethyl groups enhances its chemical stability and lipophilicity, making it potentially useful in various applications, including agrochemicals and pharmaceuticals. The chlorinated phenoxy group suggests potential herbicidal activity, as compounds with similar structures are often investigated for their efficacy in controlling unwanted vegetation. Additionally, the trifluoromethyl group is known to influence the electronic properties of the molecule, potentially affecting its reactivity and interaction with biological targets. Overall, methyl 2-chloro-5-[2-chloro-4-(trifluoromethyl)phenoxy]benzoate is a compound of interest in chemical research, particularly in the fields of medicinal chemistry and agricultural science.
Formula:C15H9Cl2F3O3
InChI:InChI=1/C15H9Cl2F3O3/c1-22-14(21)10-7-9(3-4-11(10)16)23-13-5-2-8(6-12(13)17)15(18,19)20/h2-7H,1H3
SMILES:COC(=O)c1cc(ccc1Cl)Oc1ccc(cc1Cl)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.