CAS 57027-74-4: 1-Amino-1-deoxy-D-mannitol

Description:1-Amino-1-deoxy-D-mannitol, with the CAS number 57027-74-4, is a carbohydrate derivative characterized by the presence of an amino group and a hydroxyl group, which contribute to its unique properties. This compound is a structural isomer of mannitol, differing primarily in the substitution of a hydroxyl group with an amino group at the first carbon position. It is a white to off-white crystalline solid that is soluble in water, making it suitable for various biological applications. The presence of the amino group enhances its potential as a building block in the synthesis of more complex molecules, particularly in medicinal chemistry and biochemistry. Additionally, 1-amino-1-deoxy-D-mannitol may exhibit biological activity, potentially influencing metabolic pathways or serving as a substrate for enzymatic reactions. Its stability and reactivity can be influenced by pH and temperature, which are important considerations in its handling and application in laboratory settings. Overall, this compound represents a valuable tool in both research and industrial applications.

Formula:C₆H₁₅NO₅

InChI:InChI=1S/C6H15NO5/c7-1-3(9)5(11)6(12)4(10)2-8/h3-6,8-12H,1-2,7H2/t3-,4-,5-,6-/m1/s1

InChI key:InChIKey=SDOFMBGMRVAJNF-KVTDHHQDSA-N

SMILES:OCC(O)C(O)C(O)C(O)CN