CAS 57032-14-1

quinoline-2,3-diyldimethanol

Description:

Quinoline-2,3-diyldimethanol, identified by its CAS number 57032-14-1, is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features two hydroxymethyl (-CH2OH) groups attached to the 2 and 3 positions of the quinoline ring, contributing to its potential as a versatile building block in organic synthesis. Quinoline derivatives are known for their biological activity, including antimicrobial and antimalarial properties, making them of interest in medicinal chemistry. The presence of hydroxymethyl groups enhances its reactivity, allowing for further functionalization and modification. Additionally, quinoline-2,3-diyldimethanol may exhibit solubility in polar solvents due to the hydroxyl groups, influencing its applications in various chemical reactions and formulations. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, quinoline-2,3-diyldimethanol represents a significant compound within the realm of heterocyclic chemistry, with implications in both research and industrial applications.

Formula: C₁₁H₁₁NO₂

InChI: InChI=1/C11H11NO2/c13-6-9-5-8-3-1-2-4-10(8)12-11(9)7-14/h1-5,13-14H,6-7H2

SMILES: c1ccc2c(c1)cc(CO)c(CO)n2

Synonyms:

• 2,3-Quinolinedimethanol
• Quinoline-2,3-diyldimethanol

2,3-Quinolinedimethanol

Controlled Product

CAS: 57032-14-1

Formula: C₁₁H₁₁NO₂

Color and Shape: Neat

Molecular weight: 189.21

Ref: TR-Q700550

[3-(Hydroxymethyl)quinolin-2-yl]methanol

CAS: 57032-14-1

Versatile small molecule scaffold

Formula: C₁₁H₁₁NO₂

Purity: Min. 95%

Molecular weight: 189.21 g/mol

Ref: 3D-HCA03214