CAS 570394-17-1
:methyl (3S,4S,5S,6S)-6-(4-acetamidophenoxy)-3,4,5-trihydroxy-tetrahydropyran-2-carboxylate
Description:
Methyl (3S,4S,5S,6S)-6-(4-acetamidophenoxy)-3,4,5-trihydroxy-tetrahydropyran-2-carboxylate is a complex organic compound characterized by its tetrahydropyran structure, which features multiple hydroxyl groups that contribute to its hydrophilicity and potential for hydrogen bonding. The presence of the acetamidophenoxy group suggests that it may exhibit specific biological activity, possibly influencing its solubility and interaction with biological targets. This compound is likely to be a chiral molecule, given the specified stereochemistry at the 3, 4, 5, and 6 positions, which can affect its pharmacokinetics and pharmacodynamics. The methyl ester functional group indicates that it may be more lipophilic than its corresponding acid, potentially enhancing its membrane permeability. Overall, this compound may have applications in medicinal chemistry, particularly in the development of therapeutics, due to its structural features that suggest bioactivity. However, specific properties such as melting point, solubility, and stability would require empirical data for comprehensive characterization.
Formula:C15H19NO8
InChI:InChI=1/C15H19NO8/c1-7(17)16-8-3-5-9(6-4-8)23-15-12(20)10(18)11(19)13(24-15)14(21)22-2/h3-6,10-13,15,18-20H,1-2H3,(H,16,17)/t10-,11-,12-,13?,15+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Acetamidophenyl β-D-glucuronide methyl ester
CAS:<p>The function of 4-Acetamidophenyl b-D-glucuronide methyl ester is expressed in the interaction with recombinant human proteins. The protein interacts with cell membrane and extracellular domain. It also interacts with cancer tissue, cancer, and tumor growth. 4-Acetamidophenyl b-D-glucuronide methyl ester is a membrane protein that interacts with extracellular proteins. It is expressed in metastasis and mcf-7.</p>Formula:C15H19NO8Purity:Min. 95%Molecular weight:341.31 g/mol4-Acetamidophenyl β-D-Glucuronic Acid Methyl Ester
CAS:Controlled Product<p>Applications 4-Acetamidophenyl β-D-Glucuronic Acid Methyl Ester is an intermediate to synthesize Acetaminophen (A161220) metabolites (1).<br>References (1) Burgess, S., et al.: Anal. Biochem., 312, 228 (2003)<br></p>Formula:C15H19NO8Color and Shape:NeatMolecular weight:341.31


