CAS 57054-92-9

Pyrimidine, 5-bromo-2-chloro-4-methoxy-

Description:

Pyrimidine, 5-bromo-2-chloro-4-methoxy- is a heterocyclic organic compound characterized by a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This specific compound features a bromine atom at the 5-position, a chlorine atom at the 2-position, and a methoxy group (-OCH3) at the 4-position of the pyrimidine ring. These substituents contribute to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of halogens (bromine and chlorine) can enhance the compound's biological activity and influence its interaction with biological targets. The methoxy group can also affect solubility and polarity, making the compound suitable for various synthetic pathways. Pyrimidine derivatives are often studied for their role in nucleic acids and as building blocks in medicinal chemistry. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact.

Formula: C₅H₄BrClN₂O

InChI: InChI=1/C5H4BrClN2O/c1-10-4-3(6)2-8-5(7)9-4/h2H,1H3

SMILES: COc1c(cnc(Cl)n1)Br

Synonyms:

• 5-Bromo-2-Chloro-4-Methoxypyrimidine

5-Bromo-2-chloro-4-methoxypyrimidine

CAS: 57054-92-9

Formula: C₅H₄BrClN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 223.4551

Ref: IN-DA003MGS

5-Bromo-2-chloro-4-methoxypyrimidine

CAS: 57054-92-9

5-Bromo-2-chloro-4-methoxypyrimidine

Purity: ≥95%

Color and Shape: Powder

Molecular weight: 223.46g/mol

Ref: 54-OR3706

5-Bromo-2-chloro-4-methoxypyrimidine

CAS: 57054-92-9

Purity: 98%

Molecular weight: 223.46

Ref: FT-B1812

5-Bromo-2-chloro-4-methoxypyrimidine

CAS: 57054-92-9

Formula: C₅H₄BrClN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 223.45

Ref: 10-F077971