CAS 57056-39-0
:3-(carboxymethyl)pentanedioic acid
Description:
3-(Carboxymethyl)pentanedioic acid, also known as 3-carboxymethylglutaric acid, is an organic compound characterized by its dicarboxylic acid structure. It features two carboxylic acid groups (-COOH) and a carboxymethyl group (-CH2COOH) attached to a five-carbon backbone. This compound is typically a white crystalline solid that is soluble in water due to the presence of multiple polar functional groups. Its molecular structure allows it to participate in various chemical reactions, including esterification and amidation, making it useful in organic synthesis and as a building block in pharmaceuticals and biochemistry. The presence of multiple acidic groups also suggests potential applications in chelation chemistry, where it can bind metal ions. Additionally, its properties may be influenced by pH, temperature, and concentration, which can affect its solubility and reactivity. Overall, 3-(carboxymethyl)pentanedioic acid is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C7H10O6
InChI:InChI=1/C7H10O6/c8-5(9)1-4(2-6(10)11)3-7(12)13/h4H,1-3H2,(H,8,9)(H,10,11)(H,12,13)
SMILES:C(C(CC(=O)O)CC(=O)O)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-(Carboxymethyl)pentanedioic acid
CAS:3-(Carboxymethyl)pentanedioic acid is a chiral molecule with a copper complex. It has been shown to be a primary target for benzyl and allyl groups as ligands, although it can also form metal ion complexes. 3-(Carboxymethyl)pentanedioic acid is soluble in alkali metal, hydroxyl group, and c1-4 alkyl solvents. It crystallizes in the orthorhombic space group P2(1)/n with unit cell dimensions of a=8.79 Å, b=6.02 Å, c=5.55 Å, β=105.11° and Z=4 for x-ray diffraction studies at room temperature.Formula:C7H10O6Purity:Min. 95%Molecular weight:190.15 g/mol
