CAS 57061-71-9
:1-(2-Chloroethyl)-4-[3-(trifluoromethyl)phenyl]piperazine
Description:
1-(2-Chloroethyl)-4-[3-(trifluoromethyl)phenyl]piperazine, with the CAS number 57061-71-9, is a chemical compound characterized by its piperazine core structure, which is a six-membered ring containing two nitrogen atoms. This compound features a chloroethyl group, which enhances its reactivity and potential biological activity, and a trifluoromethyl-substituted phenyl group that contributes to its lipophilicity and may influence its pharmacological properties. The presence of the trifluoromethyl group often enhances the compound's metabolic stability and can affect its interaction with biological targets. This compound is of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential applications in treating various conditions. Its unique structural features may also impart specific properties such as solubility, binding affinity, and selectivity towards certain receptors or enzymes. As with many chemical substances, safety and handling precautions are essential, given the presence of chlorine and fluorine, which can pose health and environmental risks.
Formula:C13H16ClF3N2
InChI:InChI=1S/C13H16ClF3N2/c14-4-5-18-6-8-19(9-7-18)12-3-1-2-11(10-12)13(15,16)17/h1-3,10H,4-9H2
InChI key:InChIKey=LEOMYSVONJGULL-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=CC1)N2CCN(CCCl)CC2
Synonyms:- 1-(2-Chloroethyl)-4-[3-(Trifluoromethyl)Phenyl]Piperazine Dihydrochloride
- 1-(2-Chloroethyl)-4-[3-(trifluoromethyl)phenyl]piperazine
- Piperazine, 1-(2-chloroethyl)-4-[3-(trifluoromethyl)phenyl]-
- 1-(2-CHLORO-ETHYL)-4-(3-TRIFLUOROMETHYL-PHENYL)-PIPERAZINE(WXG02663)
- Piperazine,1-(2-chloroethyl)-4-[3-(trifluoromethyl)phenyl]-dihydrochloride
- Piperazine,1-(2-chloroethyl)-4-[3-(trifluoromethyl)phenyl]- dihydrochloride
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery