CAS 5707-73-3
:3-Methyl-4-(m-chlorophenylhydrazono)-5-isoxazolone
Description:
3-Methyl-4-(m-chlorophenylhydrazono)-5-isoxazolone, with the CAS number 5707-73-3, is a chemical compound that belongs to the class of isoxazolones, which are five-membered heterocyclic compounds containing both nitrogen and oxygen. This specific compound features a hydrazone functional group, which is formed by the reaction of a hydrazine with a carbonyl compound, contributing to its reactivity and potential biological activity. The presence of the m-chlorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. The methyl group at the 3-position of the isoxazolone ring can affect the compound's stability and solubility. Typically, isoxazolones exhibit a range of properties, including antimicrobial and anti-inflammatory activities, making them of interest in medicinal chemistry. The compound's structure suggests potential applications in pharmaceuticals, but specific biological activities and safety profiles would require further investigation through experimental studies. As with all chemical substances, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C10H8ClN3O2
InChI:InChI=1S/C10H8ClN3O2/c1-6-9(10(15)16-14-6)13-12-8-4-2-3-7(11)5-8/h2-5,12H,1H3
InChI key:InChIKey=PANCLGUYZXWRPW-UHFFFAOYSA-N
SMILES:N(NC1=CC(Cl)=CC=C1)=C2C(C)=NOC2=O
Synonyms:- 4,5-Isoxazoledione, 3-methyl-, 4-[2-(3-chlorophenyl)hydrazone]
- 4,5-Isoxazoledione, 3-methyl-, 4-[(m-chlorophenyl)hydrazone]
- (4Z)-4-[2-(3-chlorophenyl)hydrazinylidene]-3-methyl-1,2-oxazol-5(4H)-one
- 4-(m-Chlorophenylhydrazono)-3-methyl-5-isoxazolone
- 3-Methyl-4-(m-chlorophenylhydrazono)-5-isoxazolone
- 4,5-Isoxazoledione, 3-methyl-, 4-[(3-chlorophenyl)hydrazone]
- 4-(3-chlorophenylhydrazono)-3-methylisoxazol-5-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Metazoxolon
CAS:Metazoxolon is a bioactive chemical.Formula:C10H8ClN3O2Color and Shape:SolidMolecular weight:237.64
