CAS 57072-36-3
:Queuosine
Description:
Queuosine is a naturally occurring modified nucleoside found in the tRNA of various organisms, including bacteria and eukaryotes. It is classified as a guanosine derivative, specifically a 7-queuosine, and plays a crucial role in the proper functioning of tRNA during protein synthesis. Queuosine is known for its unique structure, which includes a 7-oxobenzyl group, contributing to its ability to stabilize the tRNA structure and enhance the accuracy of codon-anticodon pairing. This modification is particularly important in the translation process, as it can influence the efficiency and fidelity of protein synthesis. Queuosine is synthesized in cells through a complex biosynthetic pathway involving several enzymes. Its presence in tRNA is associated with various physiological processes, including stress response and cellular differentiation. Additionally, queuosine has been studied for its potential implications in health and disease, particularly in relation to its role in cellular metabolism and its effects on gene expression. Overall, queuosine is a significant biomolecule with essential functions in cellular biology.
Formula:C17H23N5O7
InChI:InChI=1S/C17H23N5O7/c18-17-20-14-10(15(28)21-17)6(3-19-7-1-2-8(24)11(7)25)4-22(14)16-13(27)12(26)9(5-23)29-16/h1-2,4,7-9,11-13,16,19,23-27H,3,5H2,(H3,18,20,21,28)/t7-,8-,9+,11+,12+,13+,16+/m0/s1
InChI key:InChIKey=QQXQGKSPIMGUIZ-AEZJAUAXSA-N
SMILES:C(N[C@@H]1[C@@H](O)[C@@H](O)C=C1)C=2C3=C(N(C2)[C@@H]4O[C@H](CO)[C@@H](O)[C@H]4O)NC(N)=NC3=O
Synonyms:- 4H-Pyrrolo[2,3-d]pyrimidin-4-one, 2-amino-5-[[(4,5-dihydroxy-2-cyclopenten-1-yl)amino]methyl]-1,7-dihydro-7-β-D-ribofuranosyl-, [1S-(1α,4β,5β)]-
- 4H-Pyrrolo[2,3-d]pyrimidin-4-one, 2-amino-5-[[[(1S,4S,5R)-4,5-dihydroxy-2-cyclopenten-1-yl]amino]methyl]-1,7-dihydro-7-β-D-ribofuranosyl-
- 4H-Pyrrolo[2,3-d]pyrimidin-4-one, 2-amino-5-[[[(1S,4S,5R)-4,5-dihydroxy-2-cyclopenten-1-yl]amino]methyl]-3,7-dihydro-7-β-D-ribofuranosyl-
- 7-(4,5-cis-Dihydroxy-1-cyclopenten-3-ylaminomethyl)-7-deazaguanosine
- 2-Amino-5-[[[(1S,4S,5R)-4,5-dihydroxy-2-cyclopenten-1-yl]amino]methyl]-3,7-dihydro-7-β-D-ribofuranosyl-4H-pyrrolo[2,3-d]pyrimidin-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Queuosine
CAS:Queuosine is a modified nucleoside found in the tRNA of both eukaryotic and prokaryotic organisms. It is primarily sourced from the gut microbiota and obtained through dietary intake, as humans lack the biosynthetic machinery to produce it endogenously. Queuosine plays a crucial role in cellular processes by contributing to the accuracy of protein synthesis, impacting cellular growth and maintenance. Its importance extends to understanding the molecular mechanisms underpinning various physiological processes and the potential for dysregulation in diseases. Ongoing research is exploring queuosine's implications in cellular metabolism, including its role in cancer biology and neurobiology. Understanding the pathways and effects of queuosine incorporation into tRNA may provide insights into novel therapeutic avenues for targeting metabolic disorders and diseases associated with translational fidelity.Formula:C17H23N5O7Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:409.39 g/mol

