CAS 57079-11-5
:(2Z)-4-[(2-Carboxyethyl)amino]-4-oxo-2-butenoic acid
Description:
The chemical substance known as (2Z)-4-[(2-Carboxyethyl)amino]-4-oxo-2-butenoic acid, with the CAS number 57079-11-5, is an organic compound characterized by its unique structural features. It contains a butenoic acid backbone with a keto group and an amino group that is substituted with a carboxyethyl moiety. This compound exhibits both acidic and basic properties due to the presence of carboxylic acid and amino functional groups, allowing it to participate in various chemical reactions, including acid-base interactions. Its structure suggests potential biological activity, possibly as an intermediate in metabolic pathways or as a precursor for synthesizing other bioactive molecules. The compound is likely to be soluble in polar solvents due to its ionic and polar functional groups. Additionally, its configuration as a Z-isomer indicates specific stereochemical properties that may influence its reactivity and interactions in biological systems. Overall, this compound's characteristics make it of interest in both synthetic organic chemistry and potential pharmaceutical applications.
Formula:C7H9NO5
InChI:InChI=1S/C7H9NO5/c9-5(1-2-6(10)11)8-4-3-7(12)13/h1-2H,3-4H2,(H,8,9)(H,10,11)(H,12,13)/b2-1-
InChI key:InChIKey=JYXLDXBKFBWKOV-UPHRSURJSA-N
SMILES:C(/C=C\C(O)=O)(NCCC(O)=O)=O
Synonyms:- N-(Carboxyethyl)maleamide acid
- (2Z)-4-[(2-Carboxyethyl)amino]-4-oxo-2-butenoic acid
- 2-Butenoic acid, 4-[(2-carboxyethyl)amino]-4-oxo-, (2Z)-
- 2-Butenoic acid, 4-[(2-carboxyethyl)amino]-4-oxo-, (Z)-
- Maleamic acid, N-(2-carboxyethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
cis-5-Aza-4-oxo-oct-2-en-dioic acid
CAS:cis-5-Aza-4-oxo-oct-2-en-dioic acid is a chemical that belongs to the group of reagents and is used as a reaction component. cis-5-Aza-4-oxo-oct-2-en-dioic acid has been shown to react with aniline in a one pot reaction to produce 4,6 diaminohexanoic acid. cis -5 Aza -4 oxo oct 2 en dioic acid also reacts with methyl acetoacetate in a one pot reaction to produce 3,4,5 triamino pentanoic acid. cis -5 Aza -4 oxo oct 2 en dioic acid is versatile and can be used as a building block or an intermediate for complex compounds. It has been shown to be useful in the synthesis of fine chemicals, such as benzofuran derivatives.
Formula:C7H9NO5Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:187.15 g/mol
