
CAS 57082-24-3
:Caryophyllene acetate
Description:
Caryophyllene acetate is a natural bicyclic sesquiterpene and a derivative of caryophyllene, commonly found in essential oils of various plants, particularly in clove oil and cannabis. It is characterized by its distinctive spicy, woody aroma, which contributes to its use in perfumery and flavoring. The compound has a molecular formula of C15H24O2 and features a bicyclo[3.3.0]octane structure, which is typical of many sesquiterpenes. Caryophyllene acetate is known for its potential therapeutic properties, including anti-inflammatory and analgesic effects, and it may also exhibit antimicrobial activity. Additionally, it is recognized for its ability to interact with cannabinoid receptors, suggesting a role in the entourage effect of cannabis. In terms of physical properties, caryophyllene acetate is typically a colorless to pale yellow liquid with a relatively low boiling point. Its stability and solubility in organic solvents make it suitable for various applications in the fragrance and cosmetic industries. Overall, caryophyllene acetate is a compound of interest both for its sensory attributes and potential health benefits.
Formula:C17H28O2
InChI:InChI=1S/C17H28O2/c1-12(18)19-17-8-5-7-16(4,11-17)9-6-13-14(17)10-15(13,2)3/h13-14H,5-11H2,1-4H3/t13-,14+,16+,17-/m1/s1
InChI key:InChIKey=SJDDHMSVZMBJPH-YQFWSFKMSA-N
SMILES:O(C(C)=O)[C@@]12[C@@]3([C@]([C@](C)(C)C3)(CC[C@@](C)(C1)CCC2)[H])[H]
Synonyms:- Caryophyllene acetate
- Tricyclo[6.3.1.02,5]dodecan-1-ol, 4,4,8-trimethyl-, acetate, (1R,2S,5R,8S)-
- Tricyclo[6.3.1.02,5]dodecan-1-ol, 4,4,8-trimethyl-, 1-acetate, (1R,2S,5R,8S)-
- Tricyclo[6.3.1.02,5]dodecan-1-ol, 4,4,8-trimethyl-, acetate, [1R-(1α,2α,5β,8β)]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Vetynal extra
CAS:Vetynal Extra is a protein inhibitor that has shown promising results in the treatment of tumors and cancer. It works by inhibiting kinases, which are enzymes that play a key role in cell growth and division. By blocking these enzymes, Vetynal Extra can induce apoptosis or programmed cell death, which is an important mechanism for preventing the growth and spread of cancer cells. This anticancer drug is also effective against tolvaptan-resistant Chinese hamster ovary cells, making it a valuable addition to cancer treatment regimens. Additionally, Vetynal Extra has been shown to be effective in inhibiting the activity of human cancer cells, making it a promising candidate for further research into novel cancer therapies.Formula:C17H28O2Purity:Min. 95%Molecular weight:264.4 g/mol
