CAS 5709-62-6

(1-phenyl-1H-imidazol-2-yl)methanol

Description:

(1-phenyl-1H-imidazol-2-yl)methanol, with the CAS number 5709-62-6, is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a phenyl group attached to the imidazole, contributing to its aromatic properties. The presence of a hydroxymethyl group (-CH2OH) indicates that it can participate in hydrogen bonding, enhancing its solubility in polar solvents. The compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its unique structure allows for potential applications in pharmaceuticals, particularly as a building block in drug synthesis or as a ligand in coordination chemistry. Additionally, the imidazole moiety is known for its biological activity, which may suggest that (1-phenyl-1H-imidazol-2-yl)methanol could possess interesting pharmacological properties. However, specific reactivity and interaction profiles would depend on the surrounding chemical environment and conditions.

Formula: C₁₀H₁₀N₂O

InChI: InChI=1/C10H10N2O/c13-8-10-11-6-7-12(10)9-4-2-1-3-5-9/h1-7,13H,8H2

SMILES: c1ccc(cc1)n1ccnc1CO

(1-Phenyl-1H-imidazol-2-yl)methanol

CAS: 5709-62-6

Versatile small molecule scaffold

Formula: C₁₀H₁₀N₂O

Purity: Min. 95%

Molecular weight: 174.2 g/mol

Ref: 3D-FAA70962