CAS 5709-65-9

1-(4-methoxyphenyl)imidazole-2-carbaldehyde

Description:

1-(4-Methoxyphenyl)imidazole-2-carbaldehyde, with the CAS number 5709-65-9, is an organic compound characterized by its imidazole ring and an aldehyde functional group. This compound features a methoxy group attached to a phenyl ring, which contributes to its aromatic properties and potential reactivity. The imidazole moiety is known for its presence in various biological systems and can exhibit diverse biological activities, making this compound of interest in medicinal chemistry. The aldehyde group allows for further chemical modifications and can participate in various reactions, such as condensation and reduction. Additionally, the presence of the methoxy group can influence the compound's solubility, stability, and interaction with biological targets. Overall, 1-(4-methoxyphenyl)imidazole-2-carbaldehyde is a versatile compound with potential applications in pharmaceuticals and organic synthesis, owing to its unique structural features and functional groups.

Formula: C₁₁H₁₀N₂O₂

InChI: InChI=1/C11H10N2O2/c1-15-10-4-2-9(3-5-10)13-7-6-12-11(13)8-14/h2-8H,1H3

SMILES: COc1ccc(cc1)n1ccnc1C=O

1-(4-methoxyphenyl)-1H-imidazole-2-carbaldehyde

CAS: 5709-65-9

Formula: C₁₁H₁₀N₂O₂

Purity: 95.0%

Molecular weight: 202.213

Ref: 10-F308289