CAS 57097-81-1

3-bromo-5-methyl-1H-pyrazole

Description:

3-Bromo-5-methyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which consists of a five-membered ring containing two adjacent nitrogen atoms. The presence of a bromine atom at the 3-position and a methyl group at the 5-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow solid and is soluble in organic solvents. It exhibits moderate stability under standard conditions but may undergo reactions typical of halogenated compounds, such as nucleophilic substitution. 3-Bromo-5-methyl-1H-pyrazole is of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential biological activities. Its reactivity can be influenced by the electron-withdrawing nature of the bromine atom, which can affect the compound's behavior in chemical reactions. As with many pyrazole derivatives, it may serve as a building block for the synthesis of more complex molecules or as a ligand in coordination chemistry. Safety precautions should be taken when handling this compound, as with all halogenated organic substances.

Formula: C₄H₅BrN₂

InChI: InChI=1/C4H5BrN2/c1-3-2-4(5)7-6-3/h2H,1H3,(H,6,7)

SMILES: Cc1cc(Br)n[nH]1

Synonyms:

• 1H-pyrazole, 3-bromo-5-methyl-

3-Bromo-5-methyl-1H-pyrazole

CAS: 57097-81-1

Formula: C₄H₅BrN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 160.9999

Ref: IN-DA00EIC7

3-Bromo-5-methyl-2H-pyrazole

CAS: 57097-81-1

3-Bromo-5-methyl-2H-pyrazole

Purity: 98%

Color and Shape: Solid

Molecular weight: 161.00g/mol

Ref: 54-OR909643

3-Bromo-5-methyl-1H-pyrazole

CAS: 57097-81-1

Formula: C₄H₅BrN₂

Purity: 95%

Color and Shape: White powder

Molecular weight: 161.002

Ref: 10-F079115