CAS 57099-04-4

1-[(5R,6R)-6-benzyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[5,4-d][1,3]dioxol-5-yl]ethane-1,2-diol

Description:

1-[(5R,6R)-6-benzyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[5,4-d][1,3]dioxol-5-yl]ethane-1,2-diol, with the CAS number 57099-04-4, is a complex organic compound characterized by its unique structural features, including a tetrahydrofurodioxole core and a benzyloxy substituent. This compound exhibits chirality due to the presence of multiple stereocenters, specifically at the 5 and 6 positions of the tetrahydrofuro structure, which contributes to its potential biological activity. The presence of the ethane-1,2-diol moiety suggests that it may possess hydroxyl groups, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the benzyloxy group may influence its lipophilicity and overall reactivity. Such compounds are often of interest in medicinal chemistry for their potential therapeutic applications, particularly in the development of pharmaceuticals. However, detailed studies on its specific properties, such as melting point, solubility, and biological activity, would be necessary to fully understand its characteristics and potential uses.

Formula: C₁₆H₂₂O₆

InChI: InChI=1/C16H22O6/c1-16(2)21-14-13(19-9-10-6-4-3-5-7-10)12(11(18)8-17)20-15(14)22-16/h3-7,11-15,17-18H,8-9H2,1-2H3/t11?,12-,13-,14?,15?/m1/s1

SMILES: CC1(C)OC2[C@@H]([C@@H](C(CO)O)OC2O1)OCc1ccccc1

1,2-O-Isopropylidene-3-O-benzyl-D-allofuranose

CAS: 57099-04-4

Chiral resource for synthesis of bioactive sugars and antiviral nucleosides

Formula: C₁₆H₂₂O₆

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 310.34 g/mol

Ref: 3D-MI32257