CymitQuimica logo

CAS 571-58-4

:

1,4-Dimethylnaphthalene

Description:
1,4-Dimethylnaphthalene, with the CAS number 571-58-4, is an organic compound belonging to the naphthalene family. It is characterized by its structure, which consists of a naphthalene backbone with two methyl groups attached at the 1 and 4 positions. This compound is typically a colorless to pale yellow liquid or solid at room temperature, exhibiting a characteristic aromatic odor. It is relatively insoluble in water but soluble in organic solvents such as ethanol and ether. 1,4-Dimethylnaphthalene is known for its stability and resistance to oxidation, making it useful in various applications, including as a solvent and in the synthesis of other organic compounds. Additionally, it has been studied for its potential use in the production of dyes and as a component in certain industrial processes. Safety considerations include its potential irritant effects and the need for proper handling to avoid exposure. Overall, 1,4-Dimethylnaphthalene is a significant compound in organic chemistry with various industrial applications.
Formula:C12H12
InChI:InChI=1S/C12H12/c1-9-7-8-10(2)12-6-4-3-5-11(9)12/h3-8H,1-2H3
InChI key:InChIKey=APQSQLNWAIULLK-UHFFFAOYSA-N
SMILES:CC=1C2=C(C(C)=CC1)C=CC=C2
Synonyms:
  • 1,4-Dimethylnaphthalen
  • NSC 61779
  • Naphthalene, 1,4-dimethyl-
  • 1,4-Dimethylnaphthalene
Found 9 products.