CymitQuimica logo

CAS 57102-42-8

:

9-(4-bromophenyl)-9H-carbazole

Description:
9-(4-Bromophenyl)-9H-carbazole, with the CAS number 57102-42-8, is an organic compound that belongs to the class of carbazoles, which are polycyclic aromatic compounds featuring a fused carbazole structure. This compound is characterized by the presence of a bromophenyl group attached to the nitrogen atom of the carbazole moiety, which can influence its electronic properties and reactivity. It typically exhibits good thermal stability and can be soluble in organic solvents, making it suitable for various applications in organic electronics, such as in light-emitting diodes (LEDs) and organic photovoltaics. The bromine substituent can also enhance the compound's photophysical properties, potentially improving its performance in optoelectronic devices. Additionally, the presence of the aromatic rings contributes to its strong absorption in the UV-visible spectrum, which is essential for applications in photonics. Overall, this compound's unique structure and properties make it a subject of interest in materials science and organic chemistry research.
Formula:C18H12BrN
InChI:InChI=1/C18H12BrN/c19-13-9-11-14(12-10-13)20-17-7-3-1-5-15(17)16-6-2-4-8-18(16)20/h1-12H
InChI key:XSDKKRKTDZMKCH-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)c1ccccc1n2c1ccc(cc1)Br
Synonyms:
  • 9-(4-Bromophenyl)Carbazole
Found 6 products.