CAS 57102-98-4

9-Ethyl-9H-carbazole-3-carboxylic acid

Description:

9-Ethyl-9H-carbazole-3-carboxylic acid is an organic compound belonging to the carbazole family, characterized by its fused ring structure that includes a nitrogen atom. This compound features an ethyl group at the 9-position and a carboxylic acid functional group at the 3-position, which contributes to its chemical reactivity and potential applications. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the carboxylic acid group allows for hydrogen bonding, which can influence its physical properties, such as melting point and boiling point. Additionally, 9-ethyl-9H-carbazole-3-carboxylic acid may exhibit interesting photophysical properties, making it a candidate for applications in organic electronics, such as light-emitting diodes or photovoltaic devices. Its unique structure and functional groups also suggest potential utility in medicinal chemistry and materials science, although specific applications would depend on further research and development.

Formula: C₁₅H₁₃NO₂

InChI: InChI=1S/C15H13NO2/c1-2-16-13-6-4-3-5-11(13)12-9-10(15(17)18)7-8-14(12)16/h3-9H,2H2,1H3,(H,17,18)

InChI key: InChIKey=QZQNANUJNRAGPZ-UHFFFAOYSA-N

SMILES: C(C)N1C=2C(C=3C1=CC=CC3)=CC(C(O)=O)=CC2

Synonyms:

• 3-Carboxy-N-ethylcarbazole
• 9H-Carbazole-3-carboxylic acid, 9-ethyl-
• 3-Carboxy-9-ethylcarbazole
• 9-Ethyl-9H-carbazole-3-carboxylic acid
• 9-Ethyl-3-carbazolecarboxylic acid

9-ethyl-9H-Carbazole-3-carboxylic acid

CAS: 57102-98-4

Formula: C₁₅H₁₃NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 239.2692

Ref: IN-DA003A1R

9-Ethylcarbazole-3-carboxylic acid

CAS: 57102-98-4

9-Ethylcarbazole-3-carboxylic acid

Purity: 98%

Molecular weight: 239.27g/mol

Ref: 54-OR1036084

9-Ethyl-9H-carbazole-3-carboxylic acid

CAS: 57102-98-4

Purity: 95%

Molecular weight: 239.2740020751953

Ref: 10-F027340

9-Ethyl-9H-carbazole-3-carboxylic Acid

Controlled Product

CAS: 57102-98-4

Applications 9-Ethyl-9H-carbazole-3-carboxylic Acid is a useful reagent for the preparation of an oxime ester photoinitiator.
References Hu, C., & Yu, P.: Faming Zhuanli Shenqing (2020), CN 111320714 A

Formula: C₁₅H₁₃NO₂

Color and Shape: Neat

Molecular weight: 239.27

Ref: TR-E903905