CAS 57105-39-2
:N-(3-indolylacetyl)-L-alanine
Description:
N-(3-Indolylacetyl)-L-alanine, with the CAS number 57105-39-2, is a chemical compound that features a unique structure combining an indole moiety with an acetyl group attached to the amino acid L-alanine. This compound is characterized by its potential biological activity, particularly in the context of pharmacology and biochemistry, where it may exhibit properties relevant to neurotransmission and metabolic processes. The indole ring contributes to its aromatic characteristics, while the acetyl group enhances its solubility and reactivity. As a derivative of L-alanine, it retains the amino acid's basic properties, including its ability to participate in peptide bond formation. The compound's synthesis and characterization often involve techniques such as chromatography and spectroscopy to confirm its structure and purity. Its applications may extend to research in medicinal chemistry, where it could serve as a lead compound for drug development or as a biochemical probe in studies of metabolic pathways. Overall, N-(3-indolylacetyl)-L-alanine represents an interesting intersection of amino acid chemistry and indole derivatives.
Formula:C13H14N2O3
InChI:InChI=1/C13H14N2O3/c1-8(13(17)18)15-12(16)6-9-7-14-11-5-3-2-4-10(9)11/h2-5,7-8,14H,6H2,1H3,(H,15,16)(H,17,18)/t8-/m0/s1
SMILES:C[C@@H](C(=O)O)N=C(Cc1c[nH]c2ccccc12)O
Synonyms:- indole-3-acetyl-L-alanine plant cell*culture test
- N-(3-Indoleacetyl)-L-alanine
- N-(1H-indol-3-ylacetyl)-L-alanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
N-(3-Indolylacetyl)-L-alanine
CAS:Formula:C13H14N2O3Purity:95%Color and Shape:SolidMolecular weight:246.2619N-(3-Indolylacetyl)-L-alanine
CAS:N-(3-Indolylacetyl)-L-alaninePurity:95%Molecular weight:246.27g/molIndole-3-acetic-L-alanine
CAS:Controlled Product<p>Applications Indole-3-acetic-L-alanine is a derivative of the phytohormone indole-3-acetic acid (I577340) used in studies for the isolation and characterization of Arabdopsis thaliana mutants.<br>References Rampey, R.A., et al.: G3 (Bethesda), 3, 131-141 (2013)<br></p>Formula:C13H14N2O3Color and Shape:NeatMolecular weight:246.26Indole-3-acetic-L-alanine
CAS:<p>Indole-3-acetic-L-alanine is a plant hormone that regulates root formation and transport. It is found in all plants, but the concentration varies depending on the plant, tissue type, and growth conditions. It has been shown to regulate root formation in triticum aestivum by inhibiting auxin transport to the roots. Indole-3-acetic acid also inhibits auxin transport to the shoot apex, leading to increased branching in triticum aestivum. This compound is hydrolyzed by root cell enzymes into indole-3-acetate and L-alanine. Genetic mechanisms underlying this phenomenon are not well understood at this time.</p>Formula:C13H14N2O3Purity:Min. 95%Color and Shape:PowderMolecular weight:246.26 g/mol






