CymitQuimica logo

CAS 57105-58-5

:

3-(methoxycarbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid

Description:
3-(Methoxycarbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid, identified by its CAS number 57105-58-5, is a bicyclic compound featuring a unique structure that includes both a methoxycarbonyl group and a carboxylic acid functional group. This compound is characterized by its bicyclic framework, which consists of a seven-membered ring with an oxygen atom incorporated into the structure, contributing to its reactivity and potential applications in organic synthesis. The presence of the methoxycarbonyl group enhances its solubility in organic solvents and may influence its reactivity in various chemical reactions, such as esterification or amidation. Additionally, the carboxylic acid group provides acidic properties, allowing for potential interactions in biological systems or as a precursor in synthetic pathways. The compound's stereochemistry and functional groups make it of interest in medicinal chemistry and materials science, where it may serve as a building block for more complex molecules or as a ligand in coordination chemistry. Overall, its unique structural features and functional groups contribute to its versatility in chemical applications.
Formula:C9H12O5
InChI:InChI=1/C9H12O5/c1-13-9(12)7-5-3-2-4(14-5)6(7)8(10)11/h4-7H,2-3H2,1H3,(H,10,11)
SMILES:COC(=O)C1C2CCC(C1C(=O)O)O2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Endothal-monomethyl

    Controlled Product
    CAS:
    Formula:C9H12O5
    Color and Shape:Neat
    Molecular weight:200.19

    Ref: 04-C13150600

    10mg
    To inquire