CAS 57105-65-4

1-(4-chlorophenyl)-3-prop-2-yn-1-ylurea

Description:

1-(4-Chlorophenyl)-3-prop-2-yn-1-ylurea, with the CAS number 57105-65-4, is an organic compound characterized by its urea functional group and an alkyne moiety. This compound features a 4-chlorophenyl group, which contributes to its aromatic properties and potential biological activity. The presence of the prop-2-yn-1-yl group introduces a triple bond, enhancing its reactivity and making it suitable for various synthetic applications. Typically, compounds of this nature may exhibit significant pharmacological properties, including potential use in agrochemicals or pharmaceuticals. Its solubility and stability can vary depending on the solvent and environmental conditions, which are critical for its application in chemical reactions or biological systems. Additionally, the chlorophenyl substituent may influence its interaction with biological targets, making it a subject of interest in medicinal chemistry. Overall, this compound's unique structure and functional groups suggest a diverse range of potential applications in both research and industry.

Formula: C₁₀H₉ClN₂O

InChI: InChI=1/C10H9ClN2O/c1-2-7-12-10(14)13-9-5-3-8(11)4-6-9/h1,3-6H,7H2,(H2,12,13,14)

SMILES: C#CCN=C(Nc1ccc(cc1)Cl)O

1-(4-Chlorophenyl)-3-(prop-2-yn-1-yl)urea

CAS: 57105-65-4

Versatile small molecule scaffold

Formula: C₁₀H₉ClN₂O

Purity: Min. 95%

Molecular weight: 208.64 g/mol

Ref: 3D-HCA10565