CAS 5711-40-0
:Bromebric acid
Description:
Bromebric acid, with the CAS number 5711-40-0, is a chemical compound that belongs to the class of brominated organic acids. It is characterized by the presence of bromine atoms in its molecular structure, which can influence its reactivity and properties. Typically, brominated compounds exhibit unique characteristics such as increased lipophilicity and potential biological activity, making them of interest in various fields, including pharmaceuticals and agrochemicals. Bromebric acid may be utilized in organic synthesis and could serve as an intermediate in the production of other chemical compounds. Its physical properties, such as solubility, melting point, and boiling point, can vary based on its molecular structure and the presence of functional groups. Safety data sheets and handling guidelines should be consulted for information regarding toxicity and environmental impact, as brominated compounds can pose risks to health and the environment. Overall, bromebric acid represents a specific example of how halogenated compounds can play significant roles in chemical research and application.
Formula:C11H9BrO4
InChI:InChI=1/C11H9BrO4/c1-16-8-4-2-7(3-5-8)11(15)9(12)6-10(13)14/h2-6H,1H3,(H,13,14)/b9-6+
InChI key:InChIKey=UPZFHUODAYGHDZ-RMKNXTFCSA-N
SMILES:C(/C(=C\C(O)=O)/Br)(=O)C1=CC=C(OC)C=C1
Synonyms:- (2E)-3-Bromo-4-(4-methoxyphenyl)-4-oxo-2-butenoic acid
- (E)-3-p-Anisoyl-3-bromacrylsaeure
- (E)-3-p-Anisoyl-3-bromoacrylic acid
- 2-Butenoic acid, 3-bromo-4-(4-methoxyphenyl)-4-oxo-, (2E)-
- 2-Butenoic acid, 3-bromo-4-(4-methoxyphenyl)-4-oxo-, (E)-
- Acide bromebrique
- Acido bromebrico
- Acidum bromebricum
- Acrylic acid, 3-p-anisoyl-3-bromo-, (E)-
- Bromebric acid [INN:BAN]
- Bromebrinsaeure
- Unii-Fge8818Gwa
- cis-3-Bromo-3-(4-methoxybenzoyl)acrylic acid
- cis-β-(4-Methoxybenzoyl)-β-bromoacrylic acid
- Bromebric acid
- (2E)-3-Bromo-4-(p-methoxyphenyl)-4-oxo-2-butenoic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Bromebric acid
CAS:<p>Bromebric acid is a medicinal compound that has shown promising anticancer properties. It is an analog of the protein kinase inhibitor, bromosporine, and has been shown to induce apoptosis in cancer cells. Bromebric acid inhibits the activity of kinases involved in tumor growth and progression, making it a potential candidate for cancer treatment. This compound has been tested on human cancer cell lines and Chinese hamster ovary cells, showing significant inhibition of tumor growth. Additionally, Bromebric acid has been found in urine samples of patients with certain types of cancer, indicating its potential as a diagnostic marker for these diseases.</p>Formula:C11H9BrO4Purity:Min. 95%Molecular weight:285.09 g/mol

