CAS 57115-24-9

3-oxo-2-(pyridin-2-yl)butanenitrile

Description:

3-Oxo-2-(pyridin-2-yl)butanenitrile, with the CAS number 57115-24-9, is an organic compound characterized by its functional groups, including a ketone (3-oxo) and a nitrile (butanenitrile). The presence of a pyridine ring contributes to its aromatic properties and potential for various chemical interactions. This compound typically exhibits moderate polarity due to the nitrile and ketone groups, which can influence its solubility in polar solvents. The molecular structure suggests that it may participate in nucleophilic addition reactions, particularly at the carbonyl carbon, and could serve as a precursor in the synthesis of more complex molecules. Additionally, the pyridine moiety may impart specific biological activities, making it of interest in medicinal chemistry. Its stability under standard conditions is generally good, although it may be sensitive to strong bases or acids. Overall, 3-oxo-2-(pyridin-2-yl)butanenitrile is a versatile compound with potential applications in organic synthesis and pharmaceuticals.

Formula: C₉H₈N₂O

InChI: InChI=1/C9H8N2O/c1-7(12)8(6-10)9-4-2-3-5-11-9/h2-5,8H,1H3

SMILES: CC(=O)C(C#N)c1ccccn1

3-oxo-2-phenylbutanenitrile

CAS: 57115-24-9

Formula: C₉H₈N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 160.1726

Ref: IN-DA00ELKO

3-Oxo-2-(pyridin-2-yl)butanenitrile

CAS: 57115-24-9

3-Oxo-2-(pyridin-2-yl)butanenitrile

Purity: 98%

Molecular weight: 160.17g/mol

Ref: 54-OR94321

3-Oxo-2-(pyridin-2-yl)butanenitrile

CAS: 57115-24-9

Formula: C₉H₈N₂O

Purity: 98%

Molecular weight: 160.176

Ref: 10-F517429

3-Oxo-2-(pyridin-2-yl)butanenitrile

CAS: 57115-24-9

3-Oxo-2-(pyridin-2-yl)butanenitrile is a chemical compound that can be found in the natural environment. The molecule contains a nitrogen atom, and has an electron donating substituent on the side chain of the ring. 3-Oxo-2-(pyridin-2-yl)butanenitrile has been shown to have a chemical shift of 11.6 ppm and can be seen as an acceptor in proton NMR spectra. The molecule is tautomeric, meaning it exists in two forms: one where the nitrile group is attached to the oxygen atom of the pyridine ring and another where it is attached to the nitrogen atom. This molecule can also be classified as a heterocyclic compound because it has at least one heteroatom with at least two different atoms within its ring system.

Formula: C₉H₈N₂O

Purity: Min. 95%

Molecular weight: 160.17 g/mol

Ref: 3D-HCA11524