CAS 57116-96-8

2,4,6-trimethylphenyl isocyanide

Description:

2,4,6-Trimethylphenyl isocyanide, with the CAS number 57116-96-8, is an organic compound characterized by its isocyanide functional group attached to a trimethyl-substituted phenyl ring. This compound features a phenyl ring with three methyl groups located at the 2, 4, and 6 positions, contributing to its steric bulk and hydrophobic nature. Isocyanides are known for their distinctive odor and reactivity, particularly in nucleophilic addition reactions. The presence of the isocyanide group imparts unique chemical properties, making it useful in various synthetic applications, including the formation of isocyanide-based ligands in coordination chemistry. Additionally, 2,4,6-trimethylphenyl isocyanide may exhibit interesting biological activities, although specific studies on this compound may be limited. Its stability and reactivity can be influenced by the surrounding environment, including factors such as temperature and solvent polarity. As with many isocyanides, proper handling and safety precautions are essential due to potential toxicity and reactivity.

Formula: C₁₀H₁₁N

InChI: InChI=1/C10H11N/c1-7-5-8(2)10(11-4)9(3)6-7/h5-6H,1-3H3

SMILES: Cc1cc(C)c(c(C)c1)[N+]#[C-]

Synonyms:

• 2-Isocyano-1,3,5-trimethylbenzene
• Benzene, 2-Isocyano-1,3,5-Trimethyl-
• Mesityl isocyanide
• 2,4,6-Trimethylphenyl isocyanide

2-Isocyano-1,3,5-trimethylbenzene

CAS: 57116-96-8

2-Isocyano-1,3,5-trimethylbenzene is an organic solvent that is insoluble in water. It has been shown to be a bidentate ligand and a ruthenium complex. This compound has been studied in supramolecular chemistry and has shown reversible electrochemical properties.

Formula: C₁₀H₁₁N

Purity: Min. 95%

Molecular weight: 145.2 g/mol

Ref: 3D-HCA11696