CymitQuimica logo

CAS 571186-92-0

:

N-(4-methyl-3-{[4-(1-oxidopyridin-3-yl)pyrimidin-2-yl]amino}phenyl)-4-[(4-methylpiperazin-1-yl)methyl]benzamide

Description:
N-(4-methyl-3-{[4-(1-oxidopyridin-3-yl)pyrimidin-2-yl]amino}phenyl)-4-[(4-methylpiperazin-1-yl)methyl]benzamide, with CAS number 571186-92-0, is a complex organic compound characterized by its multi-functional structure, which includes various aromatic and heterocyclic moieties. This compound features a benzamide core, which is substituted with a piperazine group and a pyrimidine derivative, contributing to its potential biological activity. The presence of a methyl group enhances lipophilicity, potentially influencing its pharmacokinetic properties. The oxidopyridine and piperazine components suggest possible interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular structure indicates potential for hydrogen bonding and π-π stacking interactions, which are critical in drug-receptor binding. As with many synthetic compounds, its stability, solubility, and reactivity would depend on environmental conditions and the presence of functional groups. Further studies would be necessary to elucidate its specific biological activities and applications.
Formula:C29H31N7O2
InChI:InChI=1/C29H31N7O2/c1-21-5-10-25(18-27(21)33-29-30-12-11-26(32-29)24-4-3-13-36(38)20-24)31-28(37)23-8-6-22(7-9-23)19-35-16-14-34(2)15-17-35/h3-13,18,20H,14-17,19H2,1-2H3,(H,31,37)(H,30,32,33)
SMILES:Cc1ccc(cc1Nc1nccc(c2cccn(=O)c2)n1)NC(=O)c1ccc(cc1)CN1CCN(C)CC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.