CAS 571189-51-0
:6-Acetyl-8-cyclopentyl-5-methyl-2-[[5-(4-methylpiperazin-1-yl)pyridin-2-yl]amino]-8H-pyrido[2,3-d]pyrimidin-7-one
Description:
6-Acetyl-8-cyclopentyl-5-methyl-2-[[5-(4-methylpiperazin-1-yl)pyridin-2-yl]amino]-8H-pyrido[2,3-d]pyrimidin-7-one is a complex organic compound characterized by its multi-cyclic structure, which includes a pyrido-pyrimidine core. This compound features various functional groups, including an acetyl group and a piperazine moiety, which contribute to its potential biological activity. The presence of the cyclopentyl group adds to its hydrophobic character, influencing its solubility and interaction with biological membranes. The compound is likely to exhibit specific pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular structure suggests potential interactions with biological targets, possibly involving enzyme inhibition or receptor modulation. The CAS number 571189-51-0 uniquely identifies this substance in chemical databases, facilitating research and development efforts. Overall, the compound's intricate structure and functional groups position it as a candidate for further investigation in drug discovery and development.
Formula:C25H31N7O2
InChI:InChI=1S/C25H31N7O2/c1-16-20-15-27-25(28-21-9-8-19(14-26-21)31-12-10-30(3)11-13-31)29-23(20)32(18-6-4-5-7-18)24(34)22(16)17(2)33/h8-9,14-15,18H,4-7,10-13H2,1-3H3,(H,26,27,28,29)
InChI key:InChIKey=PBSZUBKCQUPZFE-UHFFFAOYSA-N
SMILES:O=C1N(C=2C(C(C)=C1C(C)=O)=CN=C(NC3=CC=C(C=N3)N4CCN(C)CC4)N2)C5CCCC5
Synonyms:- 6-Acetyl-8-cyclopentyl-5-methyl-2-[[5-(4-methylpiperazin-1-yl)pyridin-2-yl]amino]-8H-pyrido[2,3-d]pyrimidin-7-one
- Pyrido[2,3-d]pyrimidin-7(8H)-one, 6-acetyl-8-cyclopentyl-5-methyl-2-[[5-(4-methyl-1-piperazinyl)-2-pyridinyl]amino]-
- 6-Acetyl-8-cyclopentyl-5-methyl-2-[[5-(4-methyl-1-piperazinyl)-2-pyridinyl]amino]pyrido[2,3-d]pyrimidin-7(8H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Pyrido[2,3-d]pyrimidin-7(8H)-one, 6-acetyl-8-cyclopentyl-5-methyl-2-[[5-(4-methyl-1-piperazinyl)-2-pyridinyl]amino]-
CAS:Formula:C25H31N7O2Purity:99%Color and Shape:SolidMolecular weight:461.55936-Acetyl-8-cyclopentyl-5-methyl-2-((5-(4-methylpiperazin-1-yl)pyridin-2-yl)amino)pyrido[2,3-d]pyrimidin-7(8H)-one
CAS:6-Acetyl-8-cyclopentyl-5-methyl-2-((5-(4-methylpiperazin-1-yl)pyridin-2-yl)amino)pyrido[2,3-d]pyrimidin-7(8H)-onePurity:99%Molecular weight:461.57g/molPyrido[2,3-d]pyrimidin-7(8H)-one, 6-acetyl-8-cyclopentyl-5-methyl-2-[[5-(4-methyl-1-piperazinyl)-2-pyridinyl]amino]-
CAS:Purity:98%Molecular weight:461.57000732421875N-Methyl Palbociclib
CAS:Controlled ProductApplications N-Methyl Palbociclib is an impurity of Palbociclib (P139900), a selective inhibitor of the cyclin-dependent kinases CDK4 and CDK6 which may be useful in the treatment of breast cancer.
Formula:C25H31N7O2Color and Shape:NeatMolecular weight:461.559N-Methyl palbociclib
CAS:N-Methyl palbociclib is a compound that exhibits hepatocyte growth factor (HGF) neutralizing activity. It acts by binding to HGF and preventing its interaction with its receptor, leading to the inhibition of HGF-induced signaling pathways. N-Methyl palbociclib has been shown to inhibit the proliferation of human hepatocytes in vitro and has potential applications in the field of Life Sciences. Additionally, it has cytotoxic effects on various cell types, including those expressing epidermal growth factor (EGF)-like and neurotrophic factors receptors. This compound also exhibits inhibitory effects on interleukin-6 (IL-6) signaling, which plays a crucial role in inflammation and immune responses. Overall, N-Methyl palbociclib shows promising potential as a therapeutic agent targeting multiple pathways involved in cell growth and signaling.Formula:C25H31N7O2Purity:Min. 95%Molecular weight:461.6 g/molN-Methyl Palbociclib
CAS:N-Methyl Palbociclib is an impurity of the orally active selective CDK4 and CDK6 inhibitor Palbociclib (PD 0332991).Formula:C25H31N7O2Purity:98%Color and Shape:SolidMolecular weight:461.56






