CAS 5712-49-2
:Sodium 4-methylpiperazine-1-carbodithioate
Description:
Sodium 4-methylpiperazine-1-carbodithioate is an organic compound characterized by its unique structure, which includes a piperazine ring substituted with a methyl group and a carbodithioate functional group. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the sodium ion, which enhances its solubility. It is often used in various chemical applications, including as a reagent in organic synthesis and potentially in the development of pharmaceuticals. The presence of the carbodithioate group suggests that it may exhibit properties such as nucleophilicity and the ability to form coordination complexes with metal ions. Additionally, the compound may possess biological activity, although specific biological properties would depend on the context of its use. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance. Overall, sodium 4-methylpiperazine-1-carbodithioate is a versatile compound with applications in both research and industry.
Formula:C6H12N2S2·Na
InChI:InChI=1S/C6H12N2S2.Na/c1-7-2-4-8(5-3-7)6(9)10;/h2-5H2,1H3,(H,9,10);
InChI key:InChIKey=NJGHBWUPUMIMGF-UHFFFAOYSA-N
SMILES:C(=S)(S)N1CCN(C)CC1.[Na]
Synonyms:- 1-Piperazinecarbodithioic acid, 4-methyl-, sodium salt
- 1-Piperazinecarbodithioic acid, 4-methyl-, sodium salt (1:1)
- Sodium 4-methyl-1-piperazinedithiocarboxylate
- Sodium 4-methylpiperazine-1-carbodithioate
- Sodium N-methylpiperazinedithiocarbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.