CAS 571202-87-4

(3-bromophenoxy)(tripropan-2-yl)silane

Description:

(3-bromophenoxy)(tripropan-2-yl)silane is an organosilicon compound characterized by the presence of a silane group bonded to a phenoxy moiety and a branched alkyl group. The compound features a bromine atom attached to the aromatic ring, which can influence its reactivity and solubility. The tripropan-2-yl group, being a branched alkyl chain, contributes to the steric bulk around the silicon atom, potentially affecting its coordination chemistry and reactivity with nucleophiles. This compound may exhibit properties typical of silanes, such as the ability to form siloxane bonds upon hydrolysis, making it useful in applications like surface modification, adhesion, and as a coupling agent in various chemical processes. Additionally, the presence of the bromine substituent can provide sites for further chemical transformations, enhancing its utility in synthetic organic chemistry. Overall, (3-bromophenoxy)(tripropan-2-yl)silane is a versatile compound with potential applications in materials science and organic synthesis.

Formula: C₁₅H₂₅BrOSi

InChI: InChI=1/C15H25BrOSi/c1-11(2)18(12(3)4,13(5)6)17-15-9-7-8-14(16)10-15/h7-13H,1-6H3

SMILES: CC(C)[Si](C(C)C)(C(C)C)Oc1cccc(c1)Br

Synonyms:

• (3-Bromophenoxy)Triisopropylsilane

(3-Bromophenoxy)triisopropylsilane

CAS: 571202-87-4

(3-Bromophenoxy)triisopropylsilane

Purity: 97%

Molecular weight: 329.35g/mol

Ref: 54-OR8626