
CAS 57128-11-7
:(3R)-3,4-Dihydro-3-(3-hydroxy-2,4-dimethoxyphenyl)-2H-1-benzopyran-7-ol
Description:
(3R)-3,4-Dihydro-3-(3-hydroxy-2,4-dimethoxyphenyl)-2H-1-benzopyran-7-ol, with CAS number 57128-11-7, is a chemical compound characterized by its complex structure, which includes a benzopyran core fused with a phenolic moiety. This compound features multiple functional groups, including hydroxyl and methoxy groups, which contribute to its potential biological activity. The presence of the hydroxyl group suggests that it may exhibit antioxidant properties, while the methoxy groups can enhance lipophilicity, potentially influencing its pharmacokinetics. The stereochemistry indicated by the (3R) configuration is crucial for its biological interactions, as it may affect the compound's binding affinity to biological targets. This compound is of interest in medicinal chemistry and pharmacology, particularly for its potential therapeutic applications. Its solubility, stability, and reactivity can vary based on environmental conditions, making it a subject of study for various chemical and biological investigations.
Formula:C17H18O5
InChI:InChI=1S/C17H18O5/c1-20-14-6-5-13(17(21-2)16(14)19)11-7-10-3-4-12(18)8-15(10)22-9-11/h3-6,8,11,18-19H,7,9H2,1-2H3/t11-/m0/s1
InChI key:InChIKey=NUNFZNIXYWTZMW-NSHDSACASA-N
SMILES:O(C)C1=C(C=CC(OC)=C1O)[C@H]2CC=3C(OC2)=CC(O)=CC3
Synonyms:- (R)-Mucronulatol
- 2H-1-Benzopyran-7-ol, 3,4-dihydro-3-(3-hydroxy-2,4-dimethoxyphenyl)-, (R)-
- (3R)-3,4-Dihydro-3-(3-hydroxy-2,4-dimethoxyphenyl)-2H-1-benzopyran-7-ol
- 2H-1-Benzopyran-7-ol, 3,4-dihydro-3-(3-hydroxy-2,4-dimethoxyphenyl)-, (3R)-
- (+)-Mucronulatol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(R)-Mucronulatol
CAS:(R)-Mucronulatol is a natural product that can be used as a reference standard. The CAS number of (R)-Mucronulatol is 57128-11-7.Formula:C17H18O5Color and Shape:SolidMolecular weight:302.3
