CAS 57128-90-2
:7-pentofuranosyl-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile
Description:
7-Pentofuranosyl-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile is a chemical compound characterized by its unique structural features, which include a pyrrolo[2,3-d]pyrimidine core fused with a pentofuranosyl moiety. This compound is notable for its potential biological activity, particularly in the field of medicinal chemistry, where it may exhibit properties relevant to nucleoside analogs. The presence of the carbonitrile group contributes to its reactivity and may influence its interaction with biological targets. The compound's molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, which are critical for its biological function. Additionally, the specific arrangement of atoms and functional groups may confer unique solubility and stability characteristics, making it of interest for further research in drug development and therapeutic applications. As with many compounds in this class, understanding its physicochemical properties, such as solubility, stability under various conditions, and reactivity, is essential for evaluating its potential uses in pharmaceuticals.
Formula:C12H12N4O4
InChI:InChI=1/C12H12N4O4/c13-1-6-3-16(11-7(6)2-14-5-15-11)12-10(19)9(18)8(4-17)20-12/h2-3,5,8-10,12,17-19H,4H2
SMILES:C(#N)c1cn(c2c1cncn2)C1C(C(C(CO)O1)O)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery