CAS 5713-84-8

4-methoxybenzyl 4-(3-bromo-5-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate

Description:

4-Methoxybenzyl 4-(3-bromo-5-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate, identified by its CAS number 5713-84-8, is a complex organic compound characterized by its multi-functional structure. This substance features a hexahydroquinoline core, which is a bicyclic compound known for its potential biological activity. The presence of various substituents, such as the methoxy and ethoxy groups, contributes to its solubility and reactivity, while the bromo and hydroxy groups may enhance its pharmacological properties. The carboxylate moiety suggests potential for forming salts or participating in further chemical reactions. This compound may exhibit interesting properties in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural diversity and the presence of multiple functional groups that can interact with biological targets. However, specific biological activities, toxicity, and applications would require further investigation through experimental studies and literature review.

Formula: C₂₇H₂₈BrNO₆

InChI: InChI=1/C27H28BrNO6/c1-4-34-22-13-17(12-19(28)26(22)31)24-23(15(2)29-20-6-5-7-21(30)25(20)24)27(32)35-14-16-8-10-18(33-3)11-9-16/h8-13,24,29,31H,4-7,14H2,1-3H3

SMILES: CCOc1cc(cc(c1O)Br)C1C(=C(C)NC2=C1C(=O)CCC2)C(=O)OCc1ccc(cc1)OC

Synonyms:

• 3-Quinolinecarboxylic Acid, 4-(3-Bromo-5-Ethoxy-4-Hydroxyphenyl)-1,4,5,6,7,8-Hexahydro-2-Methyl-5-Oxo-, (4-Methoxyphenyl)Methyl Ester

(2-Phenylethyl)[(pyridin-4-yl)methyl]amine

Controlled Product

CAS: 5713-84-8

Versatile small molecule scaffold

Formula: C₁₄H₁₆N₂

Purity: Min. 95%

Molecular weight: 212.29 g/mol

Ref: 3D-FAA71384