CAS 57133-56-9

1,4-Dioxaspiro[4.5]decane-6-ethanol

Description:

1,4-Dioxaspiro[4.5]decane-6-ethanol is a chemical compound characterized by its unique spirocyclic structure, which features a dioxane ring fused to a decane framework. This compound contains two ether linkages and a hydroxyl group, contributing to its potential solubility in polar solvents. The presence of the hydroxyl group suggests that it may exhibit hydrogen bonding capabilities, influencing its physical properties such as boiling point and solubility. The spiro structure can impart rigidity to the molecule, potentially affecting its reactivity and interactions with other substances. Additionally, the compound may have applications in organic synthesis or as a building block in the development of more complex molecules. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which it is used. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.

Formula: C₁₀H₁₈O₃

InChI: InChI=1S/C10H18O3/c11-6-4-9-3-1-2-5-10(9)12-7-8-13-10/h9,11H,1-8H2

InChI key: InChIKey=RQUYFWFESBKKAW-UHFFFAOYSA-N

SMILES: C(CO)C1C2(CCCC1)OCCO2

2-{1,4-Dioxaspiro[4.5]decan-6-yl}ethan-1-ol

CAS: 57133-56-9

Versatile small molecule scaffold

Formula: C₁₀H₁₈O₃

Purity: Min. 95%

Molecular weight: 186.25 g/mol

Ref: 3D-HCA13356