CymitQuimica logo

CAS 57135-10-1

:

2-(methylsulfanyl)[1,3]thiazolo[5,4-b]pyridine

Description:
2-(Methylsulfanyl)[1,3]thiazolo[5,4-b]pyridine is a heterocyclic compound characterized by its unique structure, which includes a thiazole ring fused to a pyridine ring. This compound features a methylsulfanyl group, which contributes to its chemical reactivity and potential biological activity. The presence of sulfur in the thiazole and the methylsulfanyl group can influence its solubility and interaction with other molecules. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The molecular structure allows for potential interactions with biological targets, which could lead to applications in drug development. Additionally, the compound's stability, reactivity, and potential for forming derivatives can be influenced by the electronic and steric effects of the methylsulfanyl group. Overall, 2-(methylsulfanyl)[1,3]thiazolo[5,4-b]pyridine represents a class of compounds that may have significant implications in chemical research and pharmaceutical applications.
Formula:C7H6N2S2
InChI:InChI=1/C7H6N2S2/c1-10-7-9-5-3-2-4-8-6(5)11-7/h2-4H,1H3
Synonyms:
  • 2-(methylthio)pyrido[3,2-d][1,3]thiazole
  • 2-(Methylsulfanyl)[1,3]thiazolo[5,4-b]pyridine
  • thiazolo[5,4-b]pyridine, 2-(methylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.