CAS 57159-81-6

2-(methylsulfonyl)-1H-benzimidazole

Description:

2-(Methylsulfonyl)-1H-benzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a methylsulfonyl group. This compound typically exhibits properties associated with both the benzimidazole and sulfonyl functional groups, such as potential solubility in polar solvents and moderate stability under standard conditions. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various diseases. The presence of the methylsulfonyl group can enhance the compound's pharmacokinetic properties, such as absorption and bioavailability. Additionally, 2-(methylsulfonyl)-1H-benzimidazole may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, due to the reactivity of its functional groups. Safety and handling precautions should be observed, as with any chemical substance, to mitigate potential hazards associated with its use. Overall, this compound represents a significant area of interest in medicinal chemistry and related fields.

Formula: C₈H₈N₂O₂S

InChI: InChI=1/C8H8N2O2S/c1-13(11,12)8-9-6-4-2-3-5-7(6)10-8/h2-5H,1H3,(H,9,10)

SMILES: CS(=O)(=O)c1nc2ccccc2[nH]1

Synonyms:

• 1H-benzimidazole, 2-(methylsulfonyl)-

1H-Benzimidazole,2-(methylsulfonyl)-(9CI)

CAS: 57159-81-6

Formula: C₈H₈N₂O₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 196.2263

Ref: IN-DA00EIWA

2-Methanesulfonyl-1h-1,3-benzodiazole

CAS: 57159-81-6

2-Methanesulfonyl-1h-1,3-benzodiazole

Purity: 98%

Ref: 54-OR1041013

2-Methanesulfonyl-1h-1,3-benzodiazole

CAS: 57159-81-6

Purity: 98%

Molecular weight: 196.2200012

Ref: 10-F652796

2-(Methylsulfonyl)-1H-benzo[d]imidazole

CAS: 57159-81-6

2-(Methylsulfonyl)-1H-benzo[d]imidazole (MSBI) is a relatively new class of catalysts that can be used to promote the oxidation of alcohols. The catalytic system consists of copper, iodides, and MSBI. The first step in the catalytic cycle is the formation of a complex between MSBI and copper. This complex reacts with an alcohol to give a more reactive species, which then oxidizes iodide to iodine. The iodide is reduced back to iodide by hydrogen peroxide generated from the reaction with water. The spectrum of MSBI shows peaks at 1706 cm-1 and 1684 cm-1 due to its methyl groups, while the peak at 1202 cm-1 corresponds to the stretching vibration in the imidazole ring. Experimental results show that MSBI has a low density and high theoretical activity.

Formula: C₈H₈N₂O₂S

Purity: Min. 95%

Molecular weight: 196.22 g/mol

Ref: 3D-HCA15981