CAS 57165-01-2

N-(4-amino-2-methylphenyl)methanesulfonamide

Description:

N-(4-amino-2-methylphenyl)methanesulfonamide, also known as a sulfonamide compound, is characterized by its sulfonamide functional group, which consists of a sulfonyl (SO2) moiety attached to an amine. This compound features an amino group (-NH2) and a methyl-substituted phenyl ring, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the sulfonamide and amino groups, which can engage in hydrogen bonding. The compound may possess antibacterial properties, as many sulfonamides are known for their role as antimicrobial agents by inhibiting bacterial folic acid synthesis. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Safety and handling precautions should be observed, as with all chemical substances, particularly those with biological activity. Overall, N-(4-amino-2-methylphenyl)methanesulfonamide represents a class of compounds with significant relevance in medicinal chemistry and pharmacology.

Formula: C₈H₁₂N₂O₂S

InChI: InChI=1/C8H12N2O2S/c1-6-5-7(9)3-4-8(6)10-13(2,11)12/h3-5,10H,9H2,1-2H3

InChI key: InChIKey=ZCNPUXVZTIPREX-UHFFFAOYSA-N

SMILES: N(S(C)(=O)=O)C1=C(C)C=C(N)C=C1

Synonyms:

• N-(4-Amino-2-methylphenyl)methanesulfonamide
• Methanesulfonamide, N-(4-amino-2-methylphenyl)-

N-(4-Amino-2-methylphenyl)methanesulfonamide

CAS: 57165-01-2

Versatile small molecule scaffold

Formula: C₈H₁₂N₂O₂S

Purity: Min. 95%

Molecular weight: 200.26 g/mol

Ref: 3D-HCA16501