CAS 57165-12-5

N-(4-amino-2-fluorophenyl)acetamide

Description:

N-(4-amino-2-fluorophenyl)acetamide, with the CAS number 57165-12-5, is an organic compound characterized by its amide functional group and the presence of both an amino group and a fluorine atom on a phenyl ring. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to its ability to form hydrogen bonds. The presence of the amino group contributes to its basicity, while the fluorine atom can influence its reactivity and biological activity, often enhancing lipophilicity and altering pharmacokinetic properties. N-(4-amino-2-fluorophenyl)acetamide may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as it can serve as a building block for more complex molecules. Its specific interactions and stability can vary based on environmental conditions such as pH and temperature. Safety data should be consulted for handling and potential toxicity, as with any chemical substance.

Formula: C₈H₉FN₂O

InChI: InChI=1/C8H9FN2O/c1-5(12)11-8-3-2-6(10)4-7(8)9/h2-4H,10H2,1H3,(H,11,12)

N-(4-Amino-2-fluorophenyl)acetamide

CAS: 57165-12-5

Formula: C₈H₉FN₂O

Molecular weight: 168.1683

Ref: IN-DA00EE5B

N-(4-amino-2-fluorophenyl)acetamide hydrochloride hydrate

CAS: 57165-12-5

Formula: C₈H₁₂ClFN₂O₂

Purity: 95.0%

Molecular weight: 222.64

Ref: 10-F360190