CAS 57165-33-0

2-hydroxy-1-(2-O-methyl-D-ribofuranosyl)pyridin-4(1H)-one

Description:

2-Hydroxy-1-(2-O-methyl-D-ribofuranosyl)pyridin-4(1H)-one, with the CAS number 57165-33-0, is a chemical compound characterized by its pyridinone structure, which features a hydroxyl group and a ribofuranosyl moiety. This compound is notable for its potential biological activity, particularly in the context of medicinal chemistry and biochemistry. The presence of the 2-O-methyl-D-ribofuranosyl group suggests that it may exhibit properties related to nucleosides, potentially influencing its interaction with biological systems. The hydroxyl group contributes to its solubility and reactivity, while the pyridine ring can participate in various chemical reactions, including coordination with metal ions. This compound may also exhibit antioxidant properties and could be of interest in the development of therapeutic agents. Its structural features indicate that it may play a role in various biochemical pathways, making it a subject of interest for further research in pharmacology and related fields.

Formula: C₁₁H₁₅NO₆

InChI: InChI=1/C11H15NO6/c1-17-10-9(16)7(5-13)18-11(10)12-3-2-6(14)4-8(12)15/h2-4,7,9-11,13,15-16H,5H2,1H3/t7-,9-,10-,11?/m1/s1

SMILES: CO[C@@H]1[C@@H]([C@@H](CO)OC1n1ccc(=O)cc1O)O

3-Deaza-2'-O-methyluridine

CAS: 57165-33-0

3-Deaza-2'-O-methyluridine is a nucleoside that is used as an antiviral agent and in the treatment of leukemia. It has been shown to inhibit the growth of L1210 cells in a dose-dependent manner. 3-Deaza-2'-O-methyluridine also inhibits the synthesis of DNA, RNA, and proteins. The compound is eliminated by renal excretion with a plasma elimination half life of 9 hours. This drug can be administered intramuscularly or intravenously at a dosage of 10 mg/kg every 8 hours, but should not be given more than 5 days without interruption due to accumulation in tissues.

Formula: C₁₁H₁₅NO₆

Purity: Min. 95%

Molecular weight: 257.24 g/mol

Ref: 3D-ND58308