CAS 57184-23-3
:Cyclohexylmethylpiperazine; 97%
Description:
Cyclohexylmethylpiperazine, with the CAS number 57184-23-3, is an organic compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a cyclohexyl group and a methyl group attached to the piperazine, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. Cyclohexylmethylpiperazine is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. It exhibits moderate solubility in water and is more soluble in organic solvents, making it versatile for different chemical reactions and formulations. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Proper storage in a cool, dry place, away from incompatible substances, is essential to maintain its stability and efficacy.
Formula:C11H22N2
InChI:InChI=1/C11H22N2/c1-2-4-11(5-3-1)10-13-8-6-12-7-9-13/h11-12H,1-10H2
SMILES:C1CCC(CC1)CN1CCNCC1
Synonyms:- 1-Cyclohexylmethylpiperazine
- 1-(cyclohexylmethyl)piperazine hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-(Cyclohexylmethyl)piperazine
CAS:Formula:C11H22N2Purity:98%Color and Shape:LiquidMolecular weight:182.30581-(Cyclohexylmethyl)piperazine
CAS:<p>1-(Cyclohexylmethyl)piperazine</p>Formula:C11H22N2Purity:97%Color and Shape: clear. light yellow liquidMolecular weight:182.31g/mol(1-Cyclohexylmethyl)piperazine
CAS:Formula:C11H22N2Purity:98%Color and Shape:LiquidMolecular weight:182.3111-(Cyclohexylmethyl)piperazine
CAS:Controlled Product<p>1-(Cyclohexylmethyl)piperazine (PBTZ169) is a covalent inhibitor of the enzyme nitric oxide synthase, which is a drug target for the treatment of cancer. PBTZ169 has shown inhibitory activity against tumor cell lines and clinical studies have shown that it can induce tumor regression in mice. The mechanism of action of this drug is not yet fully understood, but it has been shown to form stable covalent adducts with pyrrole-containing enzymes such as nitric oxide synthase. This interaction may be due to its nucleophilic character.</p>Formula:C11H22N2Purity:Min. 95%Molecular weight:182.31 g/mol



