CAS 57184-25-5
:1-(Cyclopropylmethyl)piperazine
Description:
1-(Cyclopropylmethyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a cyclopropylmethyl group attached to one of the nitrogen atoms introduces unique steric and electronic properties, influencing its reactivity and potential biological activity. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is soluble in polar organic solvents, which is indicative of its moderate polarity. The piperazine moiety is known for its role in various pharmacological applications, including as a scaffold in drug design, particularly in the development of psychoactive and anti-anxiety medications. The cyclopropyl group can enhance the binding affinity of the compound to certain receptors, making it of interest in medicinal chemistry. Safety data should be consulted for handling and exposure risks, as with any chemical substance, to ensure proper laboratory practices.
Formula:C8H16N2
InChI:InChI=1/C8H16N2/c1-2-8(1)7-10-5-3-9-4-6-10/h8-9H,1-7H2
SMILES:C1CC1CN1CCNCC1
Synonyms:- Piperazine, 1-(cyclopropylmethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(cyclopropylmethyl)piperazine
CAS:Formula:C8H16N2Purity:97%Color and Shape:LiquidMolecular weight:140.22601-(Cyclopropylmethyl)piperazine
CAS:1-(Cyclopropylmethyl)piperazineFormula:C8H16N2Purity:95%Color and Shape: light brown liquidMolecular weight:140.23g/mol1-(Cyclopropylmethyl)piperazine
CAS:Formula:C8H16N2Purity:>95.0%(GC)(T)Color and Shape:Colorless to Yellow clear liquidMolecular weight:140.231-(Cyclopropylmethyl)piperazine
CAS:Formula:C8H16N2Purity:95%Color and Shape:LiquidMolecular weight:140.231-(Cyclopropylmethyl)piperazine
CAS:1-(Cyclopropylmethyl)piperazine is a drug that has been used to treat deficiencies of pyruvate kinase, which is an enzyme needed for the metabolism of pyruvate. It has also been used to treat hemisulfate deficiency and is currently being studied as a potential treatment for metabolic disorders such as diabetes. 1-(Cyclopropylmethyl)piperazine is an amorphous form of the drug that can be administered orally or intravenously. This crystalline form can be administered by injection and is often given with glucose to increase absorption.Formula:C8H16N2Purity:Min. 95%Molecular weight:140.23 g/mol




