CAS 57188-46-2
:bis(4-nitrobenzyl) chlorophosphate
Description:
Bis(4-nitrobenzyl) chlorophosphate is an organophosphorus compound characterized by its structure, which includes two 4-nitrobenzyl groups attached to a chlorophosphate moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its reactivity, particularly due to the presence of the chlorophosphate functional group, which can participate in nucleophilic substitution reactions. The nitrobenzyl groups contribute to its chemical properties, including potential applications in organic synthesis and as a reagent in various chemical reactions. Bis(4-nitrobenzyl) chlorophosphate is also of interest in the field of medicinal chemistry and materials science, although handling precautions are necessary due to its potential toxicity and reactivity. As with many organophosphorus compounds, it may pose environmental and health risks, necessitating careful management and disposal. Proper safety measures should be observed when working with this substance in laboratory settings.
Formula:C14H12ClN2O7P
InChI:InChI=1/C14H12ClN2O7P/c15-25(22,23-9-11-1-5-13(6-2-11)16(18)19)24-10-12-3-7-14(8-4-12)17(20)21/h1-8H,9-10H2
SMILES:c1cc(ccc1COP(=O)(Cl)OCc1ccc(cc1)N(=O)=O)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.