CAS 57189-93-2

2-Chloro-5-(cyclopropylcarbonyl)benzenesulfonamide

Description:

2-Chloro-5-(cyclopropylcarbonyl)benzenesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of a chloro substituent at the second position and a cyclopropylcarbonyl group at the fifth position of the benzene ring contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the sulfonamide group. Its structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The sulfonamide moiety is often associated with various pharmacological activities, including antimicrobial effects. Additionally, the cyclopropyl group can influence the compound's conformational flexibility and steric properties, which may affect its binding affinity to target proteins. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity. Overall, 2-Chloro-5-(cyclopropylcarbonyl)benzenesulfonamide represents a compound with intriguing chemical properties and potential applications in drug development.

Formula: C₁₀H₁₀ClNO₃S

InChI: InChI=1S/C10H10ClNO3S/c11-8-4-3-7(10(13)6-1-2-6)5-9(8)16(12,14)15/h3-6H,1-2H2,(H2,12,14,15)

InChI key: InChIKey=AMHGYLCJWOFQKN-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(S(N)(=O)=O)=C(Cl)C=C1)C2CC2

Synonyms:

• Benzenesulfonamide, 2-chloro-5-(cyclopropylcarbonyl)-
• 2-Chloro-5-(cyclopropylcarbonyl)benzenesulfonamide
• 2-Chloro-5-cyclopropanecarbonylbenzene-1-sulfonamide

2-Chloro-5-cyclopropanecarbonylbenzene-1-sulfonamide

CAS: 57189-93-2

Versatile small molecule scaffold

Formula: C₁₀H₁₀ClNO₃S

Purity: Min. 95%

Molecular weight: 259.71 g/mol

Ref: 3D-HCA18993