CAS 571922-95-7

2-[(6-amino-4-oxo-1,4-dihydropyrimidin-2-yl)sulfanyl]-N,N-dimethylacetamide

Description:

2-[(6-amino-4-oxo-1,4-dihydropyrimidin-2-yl)sulfanyl]-N,N-dimethylacetamide, with CAS number 571922-95-7, is a chemical compound characterized by its unique structural features, which include a dihydropyrimidine core and a dimethylacetamide moiety. This compound exhibits properties typical of both heterocyclic and amide functionalities, contributing to its potential biological activity. The presence of the amino and oxo groups suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. The thioether linkage (sulfanyl group) can enhance its stability and may play a role in its interaction with biological targets. Additionally, the dimethylacetamide portion may impart lipophilicity, facilitating membrane permeability. Such characteristics make this compound of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its specific applications and efficacy would depend on further studies, including pharmacological evaluations and structure-activity relationship analyses.

Formula: C₈H₁₂N₄O₂S

InChI: InChI=1/C8H12N4O2S/c1-12(2)7(14)4-15-8-10-5(9)3-6(13)11-8/h3H,4H2,1-2H3,(H3,9,10,11,13)

SMILES: CN(C)C(=O)CSc1nc(cc(n1)O)N

2-[(4-amino-6-hydroxy-2-pyrimidinyl)thio]-N,N-dimethylacetamide

CAS: 571922-95-7

Formula: C₈H₁₂N₄O₂S

Purity: 95.0%

Molecular weight: 228.27

Ref: 10-F315513